CAS Number : A
B
C
D
E
F
G
H
I
J
K
L
M
N
O
P
Q
R
S
T
U
V
W
X
Y
Z
| CAS No. | Chemical Name |
|
| 53120-26-6 | (E,Z)-3,13-octadecadien-1-ol acetate |
| 61827-84-7 | (Octyl oxy) poly (oxyethylene) poly (oxypropylene) |
| 58594-45-9 | (Z)-13-Octadecenal |
| 34010-21-4 | (Z)-13-Octadecenyl acetate |
| 71012-10-7 | (z)-9-Octadecenoic acid, tetraglycol monoester |
| 53120-27-7 | (Z,Z)-3,13-octadecadien-1-ol acetate |
| 71585-39-2 | 1,1'-Oxybis (2,3,4-trichlorobenzene) |
| 3710-30-3 | 1,7-Octadiene |
| 58-36-6 | 10,10'-Oxybisphenoxyarsine |
| 111-87-5 | 1-Octanol |
| 3391-86-4 | 1-Octen-3-ol |
| 111-66-0 | 1-Octene |
| 148476-22-6 | 1-Oxaspiro[4,5]dec-3-en-2-one, 3-(2,4-dichlorophenyl)-4-hydroxy- |
| 148476-30-6 | 1-Oxaspiro[4.4]non-3-en-2-one, 4-hydroxy-3-(2,4,6-trimethylphenyl)- |
| 83588-44-7 | 2-(octyloxy)thiazole |
| 10213-78-2 | 2,2'-octadecyl imino diethanol |
| 14697-50-8 | 2,2'-oxybis (4,4,6-trimethyl-1,3,2-dioxaborinane) |
| 123-96-6 | 2-Octanol |
| 111-13-7 | 2-Octanone |
| 61516-68-5 | 2-Oxo-3(2H)-benzothiazolacetonitrile |
| 710-11-2 | 2-oxo-4-phenylbutanoic acid |
| 589-98-0 | 3-Octanol |
| 106-68-3 | 3-Octanone |
| 1806-26-4 | 4-Octylphenol |
| 6565-70-4 | 4-Octylresorcinol |
| 68609-93-8 | 9-Octadecenoic acid, (Z)-, sulfonated, potassium salt |
| 117-84-0 | Dl-n-Octyl phthalate |
| 2305-05-7 | gamma-n-Octyl-gamma-n-butyrolactone |
| 70-26-8 | L-Ornithine |
| 60259-81-6 | L-Ornithine Acetate Monohydrate |
| 3184-13-2 | L-Ornithine Hydrochloride |
| 3230-94-2 | L-Ornithine L-Aspartate |
| 3184-13-2 | L-Ornithine monohydrochloride |
| 593-45-3 | N-Octadecane |
| 328-04-1 | O-(2-chloro-4-nitrophenyl) O-isopropyl ethylphosphonothioate |
| 3279-46-7 | O-(2-Propynyloxy)phenyl methylcarbamate |
| 2665-30-7 | O-(4-Nitrophenyl) O-phenyl methylphosphonothioate |
| 2861-76-9 | O-(4-tert-Butyl-2-chlorophenyl) O-methyl methylphosphoramidothioate |
| 90-03-9 | O-(Chloromercuri)phenol |
| 5722-59-8 | O-(Hydroxymercuri)benzoic acid, cyclic anhydride |
| 2953-29-9 | O,O,S-Trimethyl phosphorodithiate (as impurity) |
| 2668-92-0 | O,O-diethyl O-naphthaloximido phosphorothioate |
| 2524-04-1 | O,O-diethyl phosphoro chloridothionate |
| 333-40-4 | O,O-Diethyl S-(4,6-dimethyl-2-pyrimidinyl) phosphorodithioate |
| 32345-29-2 | O,O-diethyl-O-phenyl phosphorothioate |
| 1468-37-7 | O,O-Dimethyl dithiobis(thioformate) |
| 2674-91-1 | O,O-dimethyl S-(2-(ethylsulfinyl)-1-methylethyl) phosphorothioate |
| 4212-93-5 | o-Acetotoluidide, N-(butoxymethyl)-6'-tert-butyl-2-chloro- |
| 3268-87-9 | OCDD |
| 39001-02-0 | OCDF |
| 303-47-9 | Ochratoxin A |
| 95-48-7 | O-Cresol |
| 53535-35-6 | Octachloro-2-cyclohexen-1-one |
| 2234-13-1 | Octachloronaphthalene |
| 29082-74-4 | Octachlorostyrene |
| 1592-23-0 | Octadecanoic acid, calcium salt |
| 1072-35-1 | Octadecanoic acid, lead(2+) salt |
| 3386-33-2 | Octadecyl chloride |
| 124-30-1 | Octadecylamine |
| 112-04-9 | Octadecyltrichlorosilane |
| 360-89-4 | Octafluoro-2-butene |
| 76-19-7 | Octafluoropropane |
| 556-67-2 | Octamethylcyclotetrasiloxane |
| 111-65-9 | Octane |
| 124-07-2 | Octanoic acid |
| 68332-79-6 | Octanoic acid, ester with 1,2-propanediol |
| 26402-26-6 | Octanoic acid, monoester with 1,2,3-propanetriol |
| 68815-55-4 | Octanoic acid, reaction products with 2-((2-amoniethyl)amino)ethanol,acrylic acid alkylated (1:2), disodium salts |
| 26530-20-1 | Octhilinone |
| 32426-11-2 | Octyl decyl dimethyl ammonium chloride |
| 10361-16-7 | Octyl dodecyl dimethyl ammonium chloride |
| 9002-93-1 | Octyl phenoxy poly ethoxy ethanol |
| 5466-77-3 | Octyl p-methoxycinnamate |
| 118-60-5 | Octyl salicylate |
| 5283-66-9 | Octyl trichlorosilane |
| 2212-53-5 | Octylamine 2,4-dichlorophenoxyacetate |
| 6379-37-9 | Octylammonium methanearsonate |
| 27193-28-8 | Octylphenol |
| 53404-04-9 | Octylphenoxy polyethoxy ethanol - iodine complex |
| 2703-13-1 | O-ethyl O-(4-(methylthio)phenyl) methylphosphonothioate |
| 76960-87-7 | O-Ethyl O-methyl S-propylphosphorothioate (metabolite of ethoprop) |
| 333-43-7 | O-Ethyl S-(4-methylphenyl) ethylphosphonodithioate |
| 31110-62-0 | O-Ethyl S-propyl phosphorothioic acid (Metabolite of ethoprop) |
| 58810-48-3 | Ofurace |
| 8038-65-1 | Oil of ambergis |
| 8007-70-3 | Oil of anise |
| 8006-78-8 | Oil of bay |
| 8007-75-8 | Oil of bergamot |
| 8006-82-4 | Oil of black pepper |
| 8008-98-8 | Oil of cajeput |
| 8006-80-2 | Oil of camphor sassafrassy |
| 8000-27-9 | Oil of cedarwood |
| 8002-66-2 | Oil of chamomile (Matricaria chamomilla and/or Anthemidis nobilis) |
| 8006-99-3 | Oil of chenopodium |
| 8000-29-1 | Oil of citronella |
| 8000-46-2 | Oil of geranium |
| 8022-96-6 | Oil of jasmine |
| 61789-91-1 | Oil of jojoba |
| 8000-28-0 | Oil of lavender |
| 8008-56-8 | Oil of lemon |
| 8007-02-1 | Oil of lemongrass |
| 8001-26-1 | Oil of linseed |
| 57-06-7 | Oil of mustard |
| 8008-57-9 | Oil of orange |
| 8007-44-1 | Oil of pennyroyal |
| 8006-90-4 | Oil of peppermint |
| 8002-09-3 | Oil of pine tar |
| 8000-25-7 | Oil of rosemary |
| 8014-29-7 | Oil of rue |
| 8008-79-5 | Oil of spearmint |
| 8007-46-3 | Oil of thyme |
| 119-36-8 | Oil of wintergreen |
| 68990-83-0 | Oils, cedarwood,Texan |
| 8002-75-3 | Oils, palm |
| 68647-73-4 | Oils, tea-tree |
| 112-80-1 | Oleic acid |
| 111-62-6 | Oleic acid, ethyl ester |
| 37220-82-9 | Oleic acid, glyceryl ester |
| 112-62-9 | Oleic acid, methyl ester |
| 143-18-0 | Oleic acid, potassium salt |
| 143-19-1 | Oleic acid, sodium salt |
| 70321-87-8 | Oleic acid, tetraethylenepentamine polymer |
| 2717-15-9 | Oleic acid, triethanolamine salt |
| 143-28-2 | Oleyl alcohol |
| 14351-44-1 | Oleyl dimethyl ethyl ammonium bromide |
| 53404-64-1 | Oleyl ester of isethionic acid |
| 95-38-5 | Oleyl imidazoline |
| 2388-40-1 | Oleylamine 2,4-dichlorophenoxyacetate |
| 8001-25-0 | Olive oil |
| 33079-08-2 | Omadine TBAO |
| 1113-02-6 | Omethoate |
| 152-16-9 | OMPA |
| 14639-88-4 | Opal |
| 82010-74-0 | O-Phenylphenol, alkyl amine - zinc salt of (100% C18) |
| 53404-71-0 | O-Phenylphenol, tetradecylamine salt |
| 34622-58-7 | Orbencarb |
| 1400-62-0 | Orcein |
| 37281-78-0 | Organo/modified polysiloxane |
| 67762-85-0 | Organosilicone, poly oxyalkylene ether copolymer |
| 3306-62-5 | Orthanilamide |
| 7778-39-4 | Orthoarsenic acid hemihydrate |
| 120-32-1 | Ortho-benzyl-para-chlorophenol |
| 35471-49-9 | Ortho-benzyl-para-chlorophenol, potassium salt |
| 3184-65-4 | Ortho-benzyl-para-chlorophenol, sodium salt |
| 95-50-1 | Ortho-dichlorobenzene |
| 122-51-0 | Ortho-formic acid, triethyl ester |
| 90-43-7 | Ortho-phenylphenol |
| 52704-98-0 | Ortho-phenylphenol, ammonium salt |
| 13707-65-8 | Ortho-phenylphenol, potassium salt |
| 132-27-4 | Ortho-phenylphenol, sodium salt |
| 13598-36-2 | Orthophosphorus acid |
| 213464-77-8 | Orthosulfamuron |
| 3884-95-5 | ortho-tert-Octylphenol |
| 7783-03-1 | Orthotungstic acid |
| 19044-88-3 | Oryzalin |
| 20816-12-0 | Osmium tetroxide |
| 13108-97-9 | Other chlorinated pyridines of Dowacil A-40 |
| 7055-03-0 | O-Toluanilide |
| 93-69-6 | O-tolyl biguanide |
| 74782-23-3 | Oxabetrinil |
| 39807-15-3 | Oxadiargyl |
| 19666-30-9 | Oxadiazon |
| 77732-09-3 | Oxadixyl |
| 328-42-7 | Oxalacetic acid |
| 144-62-7 | Oxalic Acid |
| 6153-56-6 | Oxalic acid dihydrate |
| 471-46-5 | Oxamide |
| 23135-22-0 | Oxamyl |
| 4489-31-0 | Oxapyrazon |
| 25316-57-8 | Oxapyrazon, compound with 2-(dimethylamino)ethanol (1:1) |
| 25316-56-7 | Oxapyrazone-sodium |
| 144651-06-9 | Oxasulfuron |
| 153197-14-9 | Oxaziclomefone |
| 7747-35-5 | Oxazolidine E |
| 9000-89-9 | Oxidase, l-amino acid |
| 68441-17-8 | Oxidized polyethylene |
| 75-56-9 | Oxirane, methyl- |
| 14698-29-4 | Oxolinic acid |
| 54841-75-7 | Oxy(bismethylene)bispropionate |
| 131-57-7 | Oxybenzone |
| 74007-80-0 | Oxybis(dibutyl(2,4,5-trichlorophenoxy)tin) |
| 56-35-9 | Oxybis(tributyltin) |
| 5259-88-1 | Oxycarboxin |
| 27304-13-8 | Oxychlordane |
| 301-12-2 | Oxydemeton-methyl |
| 57011-17-3 | Oxydiacetaldehyde |
| 68607-28-3 | Oxydiethylene bis (alkyl dimethyl ammonium chloride), alkyl derived from coconut oil fatty acids |
| 42874-03-3 | Oxyfluorfen |
| 7782-44-7 | Oxygen |
| 7783-41-7 | Oxygen difluoride |
| 2465-59-0 | Oxypurinol |
| 79-57-2 | Oxytetracycline |
| 2058-46-0 | Oxytetracycline hydrochloride |
| 2439-01-2 | Oxythioquinox |
| 10028-15-6 | Ozone |
| 140-66-9 | p-tert-Octylphenol |
유료 컨텐츠
화학제품시황
총분량 
.gif)
.gif)
